C29H37N3O2 — CID 143672622
N-[3-[4-(cyclobutanecarbonylamino)phenyl]propanimidoyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide (PubChem CID 143672622) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-[3-[4-(cyclobutanecarbonylamino)phenyl]propanimidoyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide.
| Compound Name | N-[3-[4-(cyclobutanecarbonylamino)phenyl]propanimidoyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 143672622 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | N-[3-[4-(cyclobutanecarbonylamino)phenyl]propanimidoyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide |
| SMILES | [H]/N=C(\CCc1ccc(NC(=O)C2CCC2)cc1)NC(=O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H37N3O2/c1-28(2)16-17-29(3,4)24-18-21(11-14-23(24)28)27(34)32-25(30)15-10-19-8-12-22(13-9-19)31-26(33)20-6-5-7-20/h8-9,11-14,18,20H,5-7,10,15-17H2,1-4H3,(H,31,33)(H2,30,32,34) |
| InChIKey | KPUYRMQIWCMBOA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|