C14H20FNO — CID 143672664
4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-prop-2-enylpiperidin-4-ol (PubChem CID 143672664) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-prop-2-enylpiperidin-4-ol.
| Compound Name | 4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-prop-2-enylpiperidin-4-ol |
|---|---|
| PubChem CID | 143672664 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-(4-fluorocyclohexa-2,4-dien-1-yl)-1-prop-2-enylpiperidin-4-ol |
| SMILES | C=CCN1CCC(O)(C2C=CC(F)=CC2)CC1 |
| InChI | InChI=1S/C14H20FNO/c1-2-9-16-10-7-14(17,8-11-16)12-3-5-13(15)6-4-12/h2-3,5-6,12,17H,1,4,7-11H2 |
| InChIKey | JZOXEISZIDCBKQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|