C20H18Cl2F2N6O2S — CID 143672980
[2-amino-4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-6-yl]-(2,2-difluoroethylamino)methanol (PubChem CID 143672980) has the molecular formula C20H18Cl2F2N6O2S and a molecular weight of 515.37 g/mol. Its IUPAC name is [2-amino-4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-6-yl]-(2,2-difluoroethylamino)methanol.
| Compound Name | [2-amino-4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-6-yl]-(2,2-difluoroethylamino)methanol |
|---|---|
| PubChem CID | 143672980 |
| Molecular Formula | C20H18Cl2F2N6O2S |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | [2-amino-4-[2,4-dichloro-6-(2-pyrazol-1-ylethoxy)phenyl]thieno[2,3-d]pyrimidin-6-yl]-(2,2-difluoroethylamino)methanol |
| SMILES | Nc1nc(-c2c(Cl)cc(Cl)cc2OCCn2cccn2)c2cc(C(O)NCC(F)F)sc2n1 |
| InChI | InChI=1S/C20H18Cl2F2N6O2S/c21-10-6-12(22)16(13(7-10)32-5-4-30-3-1-2-27-30)17-11-8-14(18(31)26-9-15(23)24)33-19(11)29-20(25)28-17/h1-3,6-8,15,18,26,31H,4-5,9H2,(H2,25,28,29) |
| InChIKey | MEMWTYJNOLFTIJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|