C21H25FN4O4 — CID 143673066
7-(7a-amino-2,3,4,4a,5,7-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 143673066) has the molecular formula C21H25FN4O4 and a molecular weight of 416.45 g/mol. Its IUPAC name is 7-(7a-amino-2,3,4,4a,5,7-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(7a-amino-2,3,4,4a,5,7-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143673066 |
| Molecular Formula | C21H25FN4O4 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 7-(7a-amino-2,3,4,4a,5,7-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CC3CCCNC3(N)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C21H25FN4O4/c1-30-19-16-13(18(27)14(20(28)29)9-26(16)12-4-5-12)7-15(22)17(19)25-8-11-3-2-6-24-21(11,23)10-25/h7,9,11-12,24H,2-6,8,10,23H2,1H3,(H,28,29) |
| InChIKey | RVRGXHGHCVIPTR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |