About ethane;3-prop-2-enoxyaniline
ethane;3-prop-2-enoxyaniline (PubChem CID 143673688) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;3-prop-2-enoxyaniline.
Molecular Properties
| Compound Name | ethane;3-prop-2-enoxyaniline |
| PubChem CID | 143673688 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;3-prop-2-enoxyaniline |
| SMILES | C=CCOc1cccc(N)c1.CC |
| InChI | InChI=1S/C9H11NO.C2H6/c1-2-6-11-9-5-3-4-8(10)7-9;1-2/h2-5,7H,1,6,10H2;1-2H3 |
| InChIKey | LBSWDKBHPHEAOX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-prop-2-enoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-prop-2-enoxyaniline?
The IUPAC name of ethane;3-prop-2-enoxyaniline (CID 143673688) is ethane;3-prop-2-enoxyaniline.
What is the SMILES notation for ethane;3-prop-2-enoxyaniline?
The canonical SMILES for ethane;3-prop-2-enoxyaniline is C=CCOc1cccc(N)c1.CC.
What is the InChIKey of ethane;3-prop-2-enoxyaniline?
The InChIKey is LBSWDKBHPHEAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C2H6/c1-2-6-11-9-5-3-4-8(10)7-9;1-2/h2-5,7H,1,6,10H2;1-2H3.
What are the key properties of ethane;3-prop-2-enoxyaniline?
ethane;3-prop-2-enoxyaniline has a molecular weight of 179.26 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-prop-2-enoxyaniline is sourced from PubChem (CID 143673688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).