C25H35N5O — CID 143673725
(4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(4-methylpiperazin-1-yl)-14-oxa-2,9-diazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine (PubChem CID 143673725) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is (4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(4-methylpiperazin-1-yl)-14-oxa-2,9-diazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine.
| Compound Name | (4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(4-methylpiperazin-1-yl)-14-oxa-2,9-diazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine |
|---|---|
| PubChem CID | 143673725 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (4E,6E,8Z,11Z)-8-ethylidene-9-methyl-17-(4-methylpiperazin-1-yl)-14-oxa-2,9-diazabicyclo[14.3.1]icosa-1(20),2,4,6,11,16,18-heptaen-3-amine |
| SMILES | C/C=C1/C=C/C=C/C(N)=N\c2ccc(N3CCN(C)CC3)c(c2)COC/C=C\CN1C |
| InChI | InChI=1S/C25H35N5O/c1-4-23-9-5-6-10-25(26)27-22-11-12-24(30-16-14-28(2)15-17-30)21(19-22)20-31-18-8-7-13-29(23)3/h4-12,19H,13-18,20H2,1-3H3,(H2,26,27)/b8-7-,9-5+,10-6+,23-4- |
| InChIKey | JPPOTVNVDQVFCN-SGRSDAOGSA-N |
| XLogP | 3.46 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|