C10H12N4O — CID 143674509
(4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-9-yl)methanol (PubChem CID 143674509) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is (4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-9-yl)methanol.
| Compound Name | (4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-9-yl)methanol |
|---|---|
| PubChem CID | 143674509 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-9-yl)methanol |
| SMILES | CN1Cc2nn3c(CO)ccnc3c2C1 |
| InChI | InChI=1S/C10H12N4O/c1-13-4-8-9(5-13)12-14-7(6-15)2-3-11-10(8)14/h2-3,15H,4-6H2,1H3 |
| InChIKey | ODDHYNCFMIEHHP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |