C12H14N4 — CID 143674551
11-cyclopropyl-4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene (PubChem CID 143674551) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 11-cyclopropyl-4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene.
| Compound Name | 11-cyclopropyl-4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene |
|---|---|
| PubChem CID | 143674551 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 11-cyclopropyl-4-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene |
| SMILES | CN1Cc2nn3ccc(C4CC4)nc3c2C1 |
| InChI | InChI=1S/C12H14N4/c1-15-6-9-11(7-15)14-16-5-4-10(8-2-3-8)13-12(9)16/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | GOTNFMZRBXCPSK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |