C18H17F3N6O — CID 143674557
(2R)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine (PubChem CID 143674557) has the molecular formula C18H17F3N6O and a molecular weight of 390.37 g/mol. Its IUPAC name is (2R)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine.
| Compound Name | (2R)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 143674557 |
| Molecular Formula | C18H17F3N6O |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (2R)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| SMILES | NC1CC(N2Cc3nn4nccnc4c3C2)CO[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H17F3N6O/c19-12-5-14(21)13(20)4-10(12)17-15(22)3-9(8-28-17)26-6-11-16(7-26)25-27-18(11)23-1-2-24-27/h1-2,4-5,9,15,17H,3,6-8,22H2/t9?,15?,17-/m1/s1 |
| InChIKey | KAQDXQHTAPKALF-WFSASFSWSA-N |
| XLogP | 1.71 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|