C14H23N — CID 143674573
N-ethyl-N,2,3,4,5,6-hexamethylaniline (PubChem CID 143674573) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-ethyl-N,2,3,4,5,6-hexamethylaniline.
| Compound Name | N-ethyl-N,2,3,4,5,6-hexamethylaniline |
|---|---|
| PubChem CID | 143674573 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-ethyl-N,2,3,4,5,6-hexamethylaniline |
| SMILES | CCN(C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C14H23N/c1-8-15(7)14-12(5)10(3)9(2)11(4)13(14)6/h8H2,1-7H3 |
| InChIKey | QFXGSCPPFYFKGR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |