C42H49F2N3 — CID 143675064
1-[(2Z,3E)-4-(1,1-difluoroethyl)-2-[4-(ethenylamino)butan-2-ylidene]hexa-3,5-dienyl]-N,N-bis(naphthalen-2-ylmethyl)pyrrolidin-3-amine;ethene (PubChem CID 143675064) has the molecular formula C42H49F2N3 and a molecular weight of 633.87 g/mol. Its IUPAC name is 1-[(2Z,3E)-4-(1,1-difluoroethyl)-2-[4-(ethenylamino)butan-2-ylidene]hexa-3,5-dienyl]-N,N-bis(naphthalen-2-ylmethyl)pyrrolidin-3-amine;ethene.
| Compound Name | 1-[(2Z,3E)-4-(1,1-difluoroethyl)-2-[4-(ethenylamino)butan-2-ylidene]hexa-3,5-dienyl]-N,N-bis(naphthalen-2-ylmethyl)pyrrolidin-3-amine;ethene |
|---|---|
| PubChem CID | 143675064 |
| Molecular Formula | C42H49F2N3 |
| Molecular Weight | 633.87 g/mol |
| Exact Mass | 633.39 |
| IUPAC Name | 1-[(2Z,3E)-4-(1,1-difluoroethyl)-2-[4-(ethenylamino)butan-2-ylidene]hexa-3,5-dienyl]-N,N-bis(naphthalen-2-ylmethyl)pyrrolidin-3-amine;ethene |
| SMILES | C=C.C=CNCC/C(C)=C(/C=C(\C=C)C(C)(F)F)CN1CCC(N(Cc2ccc3ccccc3c2)Cc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C40H45F2N3.C2H4/c1-5-38(40(4,41)42)25-37(30(3)19-21-43-6-2)28-44-22-20-39(29-44)45(26-31-15-17-33-11-7-9-13-35(33)23-31)27-32-16-18-34-12-8-10-14-36(34)24-32;1-2/h5-18,23-25,39,43H,1-2,19-22,26-29H2,3-4H3;1-2H2/b37-30-,38-25+; |
| InChIKey | QDRBNAUEODPTQV-MQTVPUKESA-N |
| XLogP | 10.08 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.87 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|