About diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene
diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene (PubChem CID 143675254) has the molecular formula C27H33P
and a molecular weight of 388.54 g/mol. Its IUPAC name is diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene.
Molecular Properties
| Compound Name | diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene |
| PubChem CID | 143675254 |
| Molecular Formula | C27H33P |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene |
| SMILES | C=CC.CC/C=C\CCc1ccccc1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C12H16.C3H6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-6-9-12-10-7-5-8-11-12;1-3-2/h1-10,13H;3-5,7-8,10-11H,2,6,9H2,1H3;3H,1H2,2H3/b;4-3-; |
| InChIKey | LUFCGCQUDUJBDE-LWFKIUJUSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene?
The IUPAC name of diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene (CID 143675254) is diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene.
What is the SMILES notation for diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene?
The canonical SMILES for diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene is C=CC.CC/C=C\CCc1ccccc1.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene?
The InChIKey is LUFCGCQUDUJBDE-LWFKIUJUSA-N. The full InChI is InChI=1S/C12H11P.C12H16.C3H6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-6-9-12-10-7-5-8-11-12;1-3-2/h1-10,13H;3-5,7-8,10-11H,2,6,9H2,1H3;3H,1H2,2H3/b;4-3-;.
What are the key properties of diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene?
diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene has a molecular weight of 388.54 g/mol, XLogP of 7.09, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;[(Z)-hex-3-enyl]benzene;prop-1-ene is sourced from PubChem (CID 143675254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).