About amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide
amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide (PubChem CID 143675560) has the molecular formula C16H26N4O3
and a molecular weight of 322.41 g/mol. Its IUPAC name is amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide |
| PubChem CID | 143675560 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide |
| SMILES | CC(C)Nc1cccc(C(N)O)c1.NC(=O)[C@@H]1CCCN1C=O |
| InChI | InChI=1S/C10H16N2O.C6H10N2O2/c1-7(2)12-9-5-3-4-8(6-9)10(11)13;7-6(10)5-2-1-3-8(5)4-9/h3-7,10,12-13H,11H2,1-2H3;4-5H,1-3H2,(H2,7,10)/t;5-/m.0/s1 |
| InChIKey | NJHSPMPODHHIDM-ZSCHJXSPSA-N |
| XLogP | 0.55 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide?
The IUPAC name of amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide (CID 143675560) is amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide.
What is the SMILES notation for amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide?
The canonical SMILES for amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide is CC(C)Nc1cccc(C(N)O)c1.NC(=O)[C@@H]1CCCN1C=O.
What is the InChIKey of amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide?
The InChIKey is NJHSPMPODHHIDM-ZSCHJXSPSA-N. The full InChI is InChI=1S/C10H16N2O.C6H10N2O2/c1-7(2)12-9-5-3-4-8(6-9)10(11)13;7-6(10)5-2-1-3-8(5)4-9/h3-7,10,12-13H,11H2,1-2H3;4-5H,1-3H2,(H2,7,10)/t;5-/m.0/s1.
What are the key properties of amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide?
amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide has a molecular weight of 322.41 g/mol, XLogP of 0.55, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[3-(propan-2-ylamino)phenyl]methanol;(2S)-1-formylpyrrolidine-2-carboxamide is sourced from PubChem (CID 143675560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).