C8H13NS — CID 143675972
2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanamine (PubChem CID 143675972) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanamine.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanamine |
|---|---|
| PubChem CID | 143675972 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanamine |
| SMILES | C=C/C=C(\C=C)SCCN |
| InChI | InChI=1S/C8H13NS/c1-3-5-8(4-2)10-7-6-9/h3-5H,1-2,6-7,9H2/b8-5+ |
| InChIKey | IAEAWSJDSAEIKY-VMPITWQZSA-N |
| XLogP | 1.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|