C27H39N3O2S2 — CID 143676259
ethane;methyl N-[3-(4-methylphenyl)prop-1-en-2-yl]-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carboximidothioate (PubChem CID 143676259) has the molecular formula C27H39N3O2S2 and a molecular weight of 501.76 g/mol. Its IUPAC name is ethane;methyl N-[3-(4-methylphenyl)prop-1-en-2-yl]-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carboximidothioate.
| Compound Name | ethane;methyl N-[3-(4-methylphenyl)prop-1-en-2-yl]-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carboximidothioate |
|---|---|
| PubChem CID | 143676259 |
| Molecular Formula | C27H39N3O2S2 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | ethane;methyl N-[3-(4-methylphenyl)prop-1-en-2-yl]-4-(4-propan-2-ylphenyl)sulfonylpiperazine-1-carboximidothioate |
| SMILES | C=C(Cc1ccc(C)cc1)/N=C(\SC)N1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1.CC |
| InChI | InChI=1S/C25H33N3O2S2.C2H6/c1-19(2)23-10-12-24(13-11-23)32(29,30)28-16-14-27(15-17-28)25(31-5)26-21(4)18-22-8-6-20(3)7-9-22;1-2/h6-13,19H,4,14-18H2,1-3,5H3;1-2H3/b26-25-; |
| InChIKey | FYBUZNDPPANMHM-OQKDUQJOSA-N |
| XLogP | 5.93 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|