C20H22N4S2 — CID 143676453
N'-[(3Z,5E)-5-thiophen-2-ylhepta-1,3,5-trien-4-yl]-N-(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine (PubChem CID 143676453) has the molecular formula C20H22N4S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is N'-[(3Z,5E)-5-thiophen-2-ylhepta-1,3,5-trien-4-yl]-N-(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N'-[(3Z,5E)-5-thiophen-2-ylhepta-1,3,5-trien-4-yl]-N-(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 143676453 |
| Molecular Formula | C20H22N4S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N'-[(3Z,5E)-5-thiophen-2-ylhepta-1,3,5-trien-4-yl]-N-(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine |
| SMILES | C=C/C=C(NCCNc1[nH]ncc1-c1cccs1)/C(=C\C)c1cccs1 |
| InChI | InChI=1S/C20H22N4S2/c1-3-7-17(15(4-2)18-8-5-12-25-18)21-10-11-22-20-16(14-23-24-20)19-9-6-13-26-19/h3-9,12-14,21H,1,10-11H2,2H3,(H2,22,23,24)/b15-4+,17-7- |
| InChIKey | ABRROCPGPNOTNM-CRNLNIINSA-N |
| XLogP | 5.37 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|