About [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine
[(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine (PubChem CID 143676943) has the molecular formula C15H16FNO
and a molecular weight of 245.30 g/mol. Its IUPAC name is [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine.
Molecular Properties
| Compound Name | [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine |
| PubChem CID | 143676943 |
| Molecular Formula | C15H16FNO |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine |
| SMILES | CC1=C=CCC/C(c2ccc(F)cc2)=C(/CN)O1 |
| InChI | InChI=1S/C15H16FNO/c1-11-4-2-3-5-14(15(10-17)18-11)12-6-8-13(16)9-7-12/h2,6-9H,3,5,10,17H2,1H3/b15-14+ |
| InChIKey | XRRQVYDREAJJHZ-CCEZHUSRSA-N |
| XLogP | 3.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine?
The IUPAC name of [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine (CID 143676943) is [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine.
What is the SMILES notation for [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine?
The canonical SMILES for [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine is CC1=C=CCC/C(c2ccc(F)cc2)=C(/CN)O1.
What is the InChIKey of [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine?
The InChIKey is XRRQVYDREAJJHZ-CCEZHUSRSA-N. The full InChI is InChI=1S/C15H16FNO/c1-11-4-2-3-5-14(15(10-17)18-11)12-6-8-13(16)9-7-12/h2,6-9H,3,5,10,17H2,1H3/b15-14+.
What are the key properties of [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine?
[(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine has a molecular weight of 245.30 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-3-(4-fluorophenyl)-8-methyl-1-oxacycloocta-2,6,7-trien-2-yl]methanamine is sourced from PubChem (CID 143676943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).