C31H30F2N4O3 — CID 143677171
(Z)-[amino-[2-[4-[[4-butyl-1-[(2,5-difluorophenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]methylidene]carbamic acid (PubChem CID 143677171) has the molecular formula C31H30F2N4O3 and a molecular weight of 544.60 g/mol. Its IUPAC name is (Z)-[amino-[2-[4-[[4-butyl-1-[(2,5-difluorophenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[2-[4-[[4-butyl-1-[(2,5-difluorophenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 143677171 |
| Molecular Formula | C31H30F2N4O3 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | (Z)-[amino-[2-[4-[[4-butyl-1-[(2,5-difluorophenyl)methyl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]methylidene]carbamic acid |
| SMILES | CCCCc1nc(C)n(Cc2cc(F)ccc2F)c(=O)c1Cc1ccc(-c2ccccc2/C(N)=N/C(=O)O)cc1 |
| InChI | InChI=1S/C31H30F2N4O3/c1-3-4-9-28-26(30(38)37(19(2)35-28)18-22-17-23(32)14-15-27(22)33)16-20-10-12-21(13-11-20)24-7-5-6-8-25(24)29(34)36-31(39)40/h5-8,10-15,17H,3-4,9,16,18H2,1-2H3,(H2,34,36)(H,39,40) |
| InChIKey | CVMNRVRIJOCKIW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|