C36H39FN4O2 — CID 143677303
N-[C-[2-[4-[[1-[4-(cyclobutylmethyl)-3-fluorophenyl]-2-methyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]-N-ethylcarbonimidoyl]formamide (PubChem CID 143677303) has the molecular formula C36H39FN4O2 and a molecular weight of 578.73 g/mol. Its IUPAC name is N-[C-[2-[4-[[1-[4-(cyclobutylmethyl)-3-fluorophenyl]-2-methyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]-N-ethylcarbonimidoyl]formamide.
| Compound Name | N-[C-[2-[4-[[1-[4-(cyclobutylmethyl)-3-fluorophenyl]-2-methyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]-N-ethylcarbonimidoyl]formamide |
|---|---|
| PubChem CID | 143677303 |
| Molecular Formula | C36H39FN4O2 |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | N-[C-[2-[4-[[1-[4-(cyclobutylmethyl)-3-fluorophenyl]-2-methyl-6-oxo-4-propylpyrimidin-5-yl]methyl]phenyl]phenyl]-N-ethylcarbonimidoyl]formamide |
| SMILES | CCCc1nc(C)n(-c2ccc(CC3CCC3)c(F)c2)c(=O)c1Cc1ccc(-c2ccccc2/C(=N/CC)NC=O)cc1 |
| InChI | InChI=1S/C36H39FN4O2/c1-4-9-34-32(36(43)41(24(3)40-34)29-19-18-28(33(37)22-29)20-25-10-8-11-25)21-26-14-16-27(17-15-26)30-12-6-7-13-31(30)35(38-5-2)39-23-42/h6-7,12-19,22-23,25H,4-5,8-11,20-21H2,1-3H3,(H,38,39,42) |
| InChIKey | OHTYWCSWWRGCEH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|