About ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine
ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine (PubChem CID 143677709) has the molecular formula C17H38N2O
and a molecular weight of 286.50 g/mol. Its IUPAC name is ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine |
| PubChem CID | 143677709 |
| Molecular Formula | C17H38N2O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.30 |
| IUPAC Name | ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine |
| SMILES | C=O.CC.CC.CN1CCCCC1CN1CCCCC1 |
| InChI | InChI=1S/C12H24N2.2C2H6.CH2O/c1-13-8-6-3-7-12(13)11-14-9-4-2-5-10-14;3*1-2/h12H,2-11H2,1H3;2*1-2H3;1H2 |
| InChIKey | PFFSFEQGQPDSLV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine?
The IUPAC name of ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine (CID 143677709) is ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine.
What is the SMILES notation for ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine?
The canonical SMILES for ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine is C=O.CC.CC.CN1CCCCC1CN1CCCCC1.
What is the InChIKey of ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine?
The InChIKey is PFFSFEQGQPDSLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.2C2H6.CH2O/c1-13-8-6-3-7-12(13)11-14-9-4-2-5-10-14;3*1-2/h12H,2-11H2,1H3;2*1-2H3;1H2.
What are the key properties of ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine?
ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine has a molecular weight of 286.50 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formaldehyde;1-methyl-2-(piperidin-1-ylmethyl)piperidine is sourced from PubChem (CID 143677709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).