About 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane
4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane (PubChem CID 143677778) has the molecular formula C12H23N3S
and a molecular weight of 241.40 g/mol. Its IUPAC name is 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane.
Molecular Properties
| Compound Name | 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane |
| PubChem CID | 143677778 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane |
| SMILES | CCC.Cc1csc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C9H15N3S.C3H8/c1-8-7-13-9(10-8)12-5-3-11(2)4-6-12;1-3-2/h7H,3-6H2,1-2H3;3H2,1-2H3 |
| InChIKey | WMSUYJCWTNILRQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane?
The IUPAC name of 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane (CID 143677778) is 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane.
What is the SMILES notation for 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane?
The canonical SMILES for 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane is CCC.Cc1csc(N2CCN(C)CC2)n1.
What is the InChIKey of 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane?
The InChIKey is WMSUYJCWTNILRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S.C3H8/c1-8-7-13-9(10-8)12-5-3-11(2)4-6-12;1-3-2/h7H,3-6H2,1-2H3;3H2,1-2H3.
What are the key properties of 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane?
4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane has a molecular weight of 241.40 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazole;propane is sourced from PubChem (CID 143677778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).