About propane;4-propylthiomorpholine-3-carboxylic acid
propane;4-propylthiomorpholine-3-carboxylic acid (PubChem CID 143678103) has the molecular formula C11H23NO2S
and a molecular weight of 233.38 g/mol. Its IUPAC name is propane;4-propylthiomorpholine-3-carboxylic acid.
Molecular Properties
| Compound Name | propane;4-propylthiomorpholine-3-carboxylic acid |
| PubChem CID | 143678103 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | propane;4-propylthiomorpholine-3-carboxylic acid |
| SMILES | CCC.CCCN1CCSCC1C(=O)O |
| InChI | InChI=1S/C8H15NO2S.C3H8/c1-2-3-9-4-5-12-6-7(9)8(10)11;1-3-2/h7H,2-6H2,1H3,(H,10,11);3H2,1-2H3 |
| InChIKey | MJMZKTMJAJMVEJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propane;4-propylthiomorpholine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;4-propylthiomorpholine-3-carboxylic acid?
The IUPAC name of propane;4-propylthiomorpholine-3-carboxylic acid (CID 143678103) is propane;4-propylthiomorpholine-3-carboxylic acid.
What is the SMILES notation for propane;4-propylthiomorpholine-3-carboxylic acid?
The canonical SMILES for propane;4-propylthiomorpholine-3-carboxylic acid is CCC.CCCN1CCSCC1C(=O)O.
What is the InChIKey of propane;4-propylthiomorpholine-3-carboxylic acid?
The InChIKey is MJMZKTMJAJMVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S.C3H8/c1-2-3-9-4-5-12-6-7(9)8(10)11;1-3-2/h7H,2-6H2,1H3,(H,10,11);3H2,1-2H3.
What are the key properties of propane;4-propylthiomorpholine-3-carboxylic acid?
propane;4-propylthiomorpholine-3-carboxylic acid has a molecular weight of 233.38 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane;4-propylthiomorpholine-3-carboxylic acid is sourced from PubChem (CID 143678103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).