C5H8BNO4 — CID 143678699
2-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 143678699) has the molecular formula C5H8BNO4 and a molecular weight of 156.93 g/mol. Its IUPAC name is 2-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 143678699 |
| Molecular Formula | C5H8BNO4 |
| Molecular Weight | 156.93 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 2-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CB1OC(=O)CNCC(=O)O1 |
| InChI | InChI=1S/C5H8BNO4/c1-6-10-4(8)2-7-3-5(9)11-6/h7H,2-3H2,1H3 |
| InChIKey | YKOGVVIQSRMEFR-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.93 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|