C43H66N2O11 — CID 143678885
[acetyl(propanoyl)amino] 3-[2-[2-[2-[2-[(4a,6b,9,12a-tetramethyl-10,13-dioxo-2,3,4,5,6,6a,6a,7,8,8a,9,11,12,14b-tetradecahydro-1H-picene-2-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 143678885) has the molecular formula C43H66N2O11 and a molecular weight of 787.00 g/mol. Its IUPAC name is [acetyl(propanoyl)amino] 3-[2-[2-[2-[2-[(4a,6b,9,12a-tetramethyl-10,13-dioxo-2,3,4,5,6,6a,6a,7,8,8a,9,11,12,14b-tetradecahydro-1H-picene-2-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | [acetyl(propanoyl)amino] 3-[2-[2-[2-[2-[(4a,6b,9,12a-tetramethyl-10,13-dioxo-2,3,4,5,6,6a,6a,7,8,8a,9,11,12,14b-tetradecahydro-1H-picene-2-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 143678885 |
| Molecular Formula | C43H66N2O11 |
| Molecular Weight | 787.00 g/mol |
| Exact Mass | 786.47 |
| IUPAC Name | [acetyl(propanoyl)amino] 3-[2-[2-[2-[2-[(4a,6b,9,12a-tetramethyl-10,13-dioxo-2,3,4,5,6,6a,6a,7,8,8a,9,11,12,14b-tetradecahydro-1H-picene-2-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CCC(=O)N(OC(=O)CCOCCOCCOCCOCCNC(=O)C1CCC2(C)CCC3C(=CC(=O)C4C3(C)CCC3C(C)C(=O)CCC34C)C2C1)C(C)=O |
| InChI | InChI=1S/C43H66N2O11/c1-7-37(49)45(29(3)46)56-38(50)12-18-52-20-22-54-24-25-55-23-21-53-19-17-44-40(51)30-8-13-41(4)14-9-33-31(34(41)26-30)27-36(48)39-42(5)16-11-35(47)28(2)32(42)10-15-43(33,39)6/h27-28,30,32-34,39H,7-26H2,1-6H3,(H,44,51) |
| InChIKey | PCMFJCYPESDLLW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|