C11H21Cl — CID 14367914
(E)-6-chloro-4,5,5,6-tetramethylhept-2-ene (PubChem CID 14367914) has the molecular formula C11H21Cl and a molecular weight of 188.74 g/mol. Its IUPAC name is (E)-6-chloro-4,5,5,6-tetramethylhept-2-ene.
| Compound Name | (E)-6-chloro-4,5,5,6-tetramethylhept-2-ene |
|---|---|
| PubChem CID | 14367914 |
| Molecular Formula | C11H21Cl |
| Molecular Weight | 188.74 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (E)-6-chloro-4,5,5,6-tetramethylhept-2-ene |
| SMILES | C/C=C/C(C)C(C)(C)C(C)(C)Cl |
| InChI | InChI=1S/C11H21Cl/c1-7-8-9(2)10(3,4)11(5,6)12/h7-9H,1-6H3/b8-7+ |
| InChIKey | RRWWXDMZJOKGDP-BQYQJAHWSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|