C18H18N3O5S2+ — CID 143679433
[5-[(3-methoxyphenyl)methylcarbamoyl]-3,11-dioxo-8,11λ6-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-11-ylidene]oxidanium (PubChem CID 143679433) has the molecular formula C18H18N3O5S2+ and a molecular weight of 420.49 g/mol. Its IUPAC name is [5-[(3-methoxyphenyl)methylcarbamoyl]-3,11-dioxo-8,11λ6-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-11-ylidene]oxidanium.
| Compound Name | [5-[(3-methoxyphenyl)methylcarbamoyl]-3,11-dioxo-8,11λ6-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-11-ylidene]oxidanium |
|---|---|
| PubChem CID | 143679433 |
| Molecular Formula | C18H18N3O5S2+ |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | [5-[(3-methoxyphenyl)methylcarbamoyl]-3,11-dioxo-8,11λ6-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-11-ylidene]oxidanium |
| SMILES | [H][O+]=S1(=O)CCc2c(sc3nc(C(=O)NCc4cccc(OC)c4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C18H17N3O5S2/c1-26-11-4-2-3-10(7-11)8-19-17(23)15-20-16(22)14-12-5-6-28(24,25)9-13(12)27-18(14)21-15/h2-4,7H,5-6,8-9H2,1H3,(H,19,23)(H,20,21,22)/p+1 |
| InChIKey | LCBYPYWTRDDKBL-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|