C12H25NO — CID 143679818
ethane;(1R)-2-methyl-N-propan-2-ylcyclopentane-1-carboxamide (PubChem CID 143679818) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is ethane;(1R)-2-methyl-N-propan-2-ylcyclopentane-1-carboxamide.
| Compound Name | ethane;(1R)-2-methyl-N-propan-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 143679818 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | ethane;(1R)-2-methyl-N-propan-2-ylcyclopentane-1-carboxamide |
| SMILES | CC.CC(C)NC(=O)[C@@H]1CCCC1C |
| InChI | InChI=1S/C10H19NO.C2H6/c1-7(2)11-10(12)9-6-4-5-8(9)3;1-2/h7-9H,4-6H2,1-3H3,(H,11,12);1-2H3/t8?,9-;/m1./s1 |
| InChIKey | AJCPGPQGIXHEOC-ICLMXVQUSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |