About 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan
4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan (PubChem CID 143679861) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan.
Molecular Properties
| Compound Name | 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan |
| PubChem CID | 143679861 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan |
| SMILES | C=CC1=C(/C=C\CCC)OC(C)(C)C1 |
| InChI | InChI=1S/C13H20O/c1-5-7-8-9-12-11(6-2)10-13(3,4)14-12/h6,8-9H,2,5,7,10H2,1,3-4H3/b9-8- |
| InChIKey | UQLMKYBEOAGXBL-HJWRWDBZSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan?
The IUPAC name of 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan (CID 143679861) is 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan.
What is the SMILES notation for 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan?
The canonical SMILES for 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan is C=CC1=C(/C=C\CCC)OC(C)(C)C1.
What is the InChIKey of 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan?
The InChIKey is UQLMKYBEOAGXBL-HJWRWDBZSA-N. The full InChI is InChI=1S/C13H20O/c1-5-7-8-9-12-11(6-2)10-13(3,4)14-12/h6,8-9H,2,5,7,10H2,1,3-4H3/b9-8-.
What are the key properties of 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan?
4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan has a molecular weight of 192.30 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,2-dimethyl-5-[(Z)-pent-1-enyl]-3H-furan is sourced from PubChem (CID 143679861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).