About N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane
N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane (PubChem CID 143679974) has the molecular formula C10H19N3S
and a molecular weight of 213.35 g/mol. Its IUPAC name is N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane.
Molecular Properties
| Compound Name | N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane |
| PubChem CID | 143679974 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane |
| SMILES | CC.CC(C)c1ccc(/C(N)=N/N)s1 |
| InChI | InChI=1S/C8H13N3S.C2H6/c1-5(2)6-3-4-7(12-6)8(9)11-10;1-2/h3-5H,10H2,1-2H3,(H2,9,11);1-2H3 |
| InChIKey | NIGVRUHYEHSXPZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane?
The IUPAC name of N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane (CID 143679974) is N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane.
What is the SMILES notation for N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane?
The canonical SMILES for N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane is CC.CC(C)c1ccc(/C(N)=N/N)s1.
What is the InChIKey of N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane?
The InChIKey is NIGVRUHYEHSXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S.C2H6/c1-5(2)6-3-4-7(12-6)8(9)11-10;1-2/h3-5H,10H2,1-2H3,(H2,9,11);1-2H3.
What are the key properties of N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane?
N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane has a molecular weight of 213.35 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-5-propan-2-ylthiophene-2-carboximidamide;ethane is sourced from PubChem (CID 143679974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).