About (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine
(2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine (PubChem CID 143680223) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine.
Molecular Properties
| Compound Name | (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine |
| PubChem CID | 143680223 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine |
| SMILES | C/C=C1/N=C(C(=O)O)C=C(C)N1.[H]N=C |
| InChI | InChI=1S/C8H10N2O2.CH3N/c1-3-7-9-5(2)4-6(10-7)8(11)12;1-2/h3-4,9H,1-2H3,(H,11,12);2H,1H2/b7-3+; |
| InChIKey | KVSWGTWXSHRSRA-CDQVLDCRSA-N |
| XLogP | 1.15 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine?
The IUPAC name of (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine (CID 143680223) is (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine.
What is the SMILES notation for (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine?
The canonical SMILES for (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine is C/C=C1/N=C(C(=O)O)C=C(C)N1.[H]N=C.
What is the InChIKey of (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine?
The InChIKey is KVSWGTWXSHRSRA-CDQVLDCRSA-N. The full InChI is InChI=1S/C8H10N2O2.CH3N/c1-3-7-9-5(2)4-6(10-7)8(11)12;1-2/h3-4,9H,1-2H3,(H,11,12);2H,1H2/b7-3+;.
What are the key properties of (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine?
(2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine has a molecular weight of 195.22 g/mol, XLogP of 1.15, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethylidene-6-methyl-1H-pyrimidine-4-carboxylic acid;methanimine is sourced from PubChem (CID 143680223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).