About N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide
N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide (PubChem CID 143680491) has the molecular formula C9H12FNO
and a molecular weight of 169.20 g/mol. Its IUPAC name is N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide.
Molecular Properties
| Compound Name | N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide |
| PubChem CID | 143680491 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide |
| SMILES | C=C/C=C(/CNC(C)=O)C(=C)F |
| InChI | InChI=1S/C9H12FNO/c1-4-5-9(7(2)10)6-11-8(3)12/h4-5H,1-2,6H2,3H3,(H,11,12)/b9-5- |
| InChIKey | HLTHTCVWZPFGMG-UITAMQMPSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide?
The IUPAC name of N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide (CID 143680491) is N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide.
What is the SMILES notation for N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide?
The canonical SMILES for N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide is C=C/C=C(/CNC(C)=O)C(=C)F.
What is the InChIKey of N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide?
The InChIKey is HLTHTCVWZPFGMG-UITAMQMPSA-N. The full InChI is InChI=1S/C9H12FNO/c1-4-5-9(7(2)10)6-11-8(3)12/h4-5H,1-2,6H2,3H3,(H,11,12)/b9-5-.
What are the key properties of N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide?
N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide has a molecular weight of 169.20 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z)-2-(1-fluoroethenyl)penta-2,4-dienyl]acetamide is sourced from PubChem (CID 143680491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).