C21H19N3O2 — CID 143681011
(1S,10S,14R)-10-ethynyl-1,14-dimethyl-5,16-dioxa-6,17-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-2,4(8),6,15(19),17-pentaene-14-carbonitrile (PubChem CID 143681011) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (1S,10S,14R)-10-ethynyl-1,14-dimethyl-5,16-dioxa-6,17-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-2,4(8),6,15(19),17-pentaene-14-carbonitrile.
| Compound Name | (1S,10S,14R)-10-ethynyl-1,14-dimethyl-5,16-dioxa-6,17-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-2,4(8),6,15(19),17-pentaene-14-carbonitrile |
|---|---|
| PubChem CID | 143681011 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (1S,10S,14R)-10-ethynyl-1,14-dimethyl-5,16-dioxa-6,17-diazapentacyclo[11.7.0.02,10.04,8.015,19]icosa-2,4(8),6,15(19),17-pentaene-14-carbonitrile |
| SMILES | C#C[C@@]12CCC3[C@](C)(Cc4cnoc4[C@@]3(C)C#N)C1=Cc1oncc1C2 |
| InChI | InChI=1S/C21H19N3O2/c1-4-21-6-5-16-19(2,17(21)7-15-13(9-21)10-23-25-15)8-14-11-24-26-18(14)20(16,3)12-22/h1,7,10-11,16H,5-6,8-9H2,2-3H3/t16?,19-,20-,21-/m0/s1 |
| InChIKey | ACXTXIGQHNIQRQ-MMNQRDBTSA-N |
| XLogP | 3.68 |
| TPSA | 75.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|