About 3-fluoro-2,3-dihydropyridine-5-carbaldehyde
3-fluoro-2,3-dihydropyridine-5-carbaldehyde (PubChem CID 143681207) has the molecular formula C6H6FNO
and a molecular weight of 127.12 g/mol. Its IUPAC name is 3-fluoro-2,3-dihydropyridine-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-fluoro-2,3-dihydropyridine-5-carbaldehyde |
| PubChem CID | 143681207 |
| Molecular Formula | C6H6FNO |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 3-fluoro-2,3-dihydropyridine-5-carbaldehyde |
| SMILES | O=CC1=CC(F)CN=C1 |
| InChI | InChI=1S/C6H6FNO/c7-6-1-5(4-9)2-8-3-6/h1-2,4,6H,3H2 |
| InChIKey | BVETXKBBXVCEQB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-2,3-dihydropyridine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,3-dihydropyridine-5-carbaldehyde?
The IUPAC name of 3-fluoro-2,3-dihydropyridine-5-carbaldehyde (CID 143681207) is 3-fluoro-2,3-dihydropyridine-5-carbaldehyde.
What is the SMILES notation for 3-fluoro-2,3-dihydropyridine-5-carbaldehyde?
The canonical SMILES for 3-fluoro-2,3-dihydropyridine-5-carbaldehyde is O=CC1=CC(F)CN=C1.
What is the InChIKey of 3-fluoro-2,3-dihydropyridine-5-carbaldehyde?
The InChIKey is BVETXKBBXVCEQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO/c7-6-1-5(4-9)2-8-3-6/h1-2,4,6H,3H2.
What are the key properties of 3-fluoro-2,3-dihydropyridine-5-carbaldehyde?
3-fluoro-2,3-dihydropyridine-5-carbaldehyde has a molecular weight of 127.12 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,3-dihydropyridine-5-carbaldehyde is sourced from PubChem (CID 143681207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).