C17H22INO — CID 143681597
(1S,9R,10R)-12-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one iodide (PubChem CID 143681597) has the molecular formula C17H22INO and a molecular weight of 383.27 g/mol. Its IUPAC name is (1S,9R,10R)-12-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one iodide.
| Compound Name | (1S,9R,10R)-12-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one iodide |
|---|---|
| PubChem CID | 143681597 |
| Molecular Formula | C17H22INO |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (1S,9R,10R)-12-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one iodide |
| SMILES | CC1C[C@H]2[C@H]3Cc4ccccc4[C@@]2(CC[NH2+]3)CC1=O.[I-] |
| InChI | InChI=1S/C17H21NO.HI/c1-11-8-14-15-9-12-4-2-3-5-13(12)17(14,6-7-18-15)10-16(11)19;/h2-5,11,14-15,18H,6-10H2,1H3;1H/t11?,14-,15+,17+;/m0./s1 |
| InChIKey | ANPQXJZRGWBODT-VSUVJHGESA-N |
| XLogP | -1.56 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|