C12H21N3 — CID 143681794
methanimine;2-N,2-N,5,5-tetramethylcyclohepta-1,3,6-triene-1,2-diamine (PubChem CID 143681794) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is methanimine;2-N,2-N,5,5-tetramethylcyclohepta-1,3,6-triene-1,2-diamine.
| Compound Name | methanimine;2-N,2-N,5,5-tetramethylcyclohepta-1,3,6-triene-1,2-diamine |
|---|---|
| PubChem CID | 143681794 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | methanimine;2-N,2-N,5,5-tetramethylcyclohepta-1,3,6-triene-1,2-diamine |
| SMILES | CN(C)C1=C(N)C=CC(C)(C)C=C1.[H]N=C |
| InChI | InChI=1S/C11H18N2.CH3N/c1-11(2)7-5-9(12)10(6-8-11)13(3)4;1-2/h5-8H,12H2,1-4H3;2H,1H2 |
| InChIKey | SCBVLZCGBOVKDY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|