C21H17FN4O2S — CID 143681984
2-fluoro-4-[8-(4-methylsulfinylanilino)imidazo[1,2-a]pyridin-5-yl]benzamide (PubChem CID 143681984) has the molecular formula C21H17FN4O2S and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-fluoro-4-[8-(4-methylsulfinylanilino)imidazo[1,2-a]pyridin-5-yl]benzamide.
| Compound Name | 2-fluoro-4-[8-(4-methylsulfinylanilino)imidazo[1,2-a]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 143681984 |
| Molecular Formula | C21H17FN4O2S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-fluoro-4-[8-(4-methylsulfinylanilino)imidazo[1,2-a]pyridin-5-yl]benzamide |
| SMILES | CS(=O)c1ccc(Nc2ccc(-c3ccc(C(N)=O)c(F)c3)n3ccnc23)cc1 |
| InChI | InChI=1S/C21H17FN4O2S/c1-29(28)15-5-3-14(4-6-15)25-18-8-9-19(26-11-10-24-21(18)26)13-2-7-16(20(23)27)17(22)12-13/h2-12,25H,1H3,(H2,23,27) |
| InChIKey | QHIBOJRVNGULFR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |