C22H24N6O — CID 143681997
molecular hydrogen;N-[(E)-2-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]pent-2-enylidene]ethanimidamide (PubChem CID 143681997) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is molecular hydrogen;N-[(E)-2-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]pent-2-enylidene]ethanimidamide.
| Compound Name | molecular hydrogen;N-[(E)-2-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]pent-2-enylidene]ethanimidamide |
|---|---|
| PubChem CID | 143681997 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | molecular hydrogen;N-[(E)-2-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]pent-2-enylidene]ethanimidamide |
| SMILES | [H]/N=C(C)/N=C/C(=C\CC)Nc1ccc(-c2ccc3c(c2)CNC3=O)n2ccnc12.[H][H] |
| InChI | InChI=1S/C22H22N6O.H2/c1-3-4-17(13-25-14(2)23)27-19-7-8-20(28-10-9-24-21(19)28)15-5-6-18-16(11-15)12-26-22(18)29;/h4-11,13,23,27H,3,12H2,1-2H3,(H,26,29);1H/b17-4+,23-14+,25-13+; |
| InChIKey | ZMVPFDZRJUYVBJ-VTRJAMQISA-N |
| XLogP | 4.26 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|