About ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane
ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane (PubChem CID 143682395) has the molecular formula C25H50
and a molecular weight of 350.68 g/mol. Its IUPAC name is ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane.
Molecular Properties
| Compound Name | ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane |
| PubChem CID | 143682395 |
| Molecular Formula | C25H50 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.39 |
| IUPAC Name | ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane |
| SMILES | CC.CC(C)CC1(C)CC1C1CCC1.CCC(CC)C/C=C/C(C)C |
| InChI | InChI=1S/C12H22.C11H22.C2H6/c1-9(2)7-12(3)8-11(12)10-5-4-6-10;1-5-11(6-2)9-7-8-10(3)4;1-2/h9-11H,4-8H2,1-3H3;7-8,10-11H,5-6,9H2,1-4H3;1-2H3/b;8-7+; |
| InChIKey | LZULQHWIERWMOG-BVUSFOFSSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane?
The IUPAC name of ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane (CID 143682395) is ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane.
What is the SMILES notation for ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane?
The canonical SMILES for ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane is CC.CC(C)CC1(C)CC1C1CCC1.CCC(CC)C/C=C/C(C)C.
What is the InChIKey of ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane?
The InChIKey is LZULQHWIERWMOG-BVUSFOFSSA-N. The full InChI is InChI=1S/C12H22.C11H22.C2H6/c1-9(2)7-12(3)8-11(12)10-5-4-6-10;1-5-11(6-2)9-7-8-10(3)4;1-2/h9-11H,4-8H2,1-3H3;7-8,10-11H,5-6,9H2,1-4H3;1-2H3/b;8-7+;.
What are the key properties of ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane?
ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane has a molecular weight of 350.68 g/mol, XLogP of 8.91, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-6-ethyl-2-methyloct-3-ene;[2-methyl-2-(2-methylpropyl)cyclopropyl]cyclobutane is sourced from PubChem (CID 143682395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).