C28H43N — CID 143682431
(2Z,4E,8E)-5-[(1Z)-buta-1,3-dienyl]-8-ethyl-6-[(3E)-3-ethylpenta-1,3-dien-2-yl]-12,12-dimethyltrideca-2,4,8-trien-1-imine (PubChem CID 143682431) has the molecular formula C28H43N and a molecular weight of 393.66 g/mol. Its IUPAC name is (2Z,4E,8E)-5-[(1Z)-buta-1,3-dienyl]-8-ethyl-6-[(3E)-3-ethylpenta-1,3-dien-2-yl]-12,12-dimethyltrideca-2,4,8-trien-1-imine.
| Compound Name | (2Z,4E,8E)-5-[(1Z)-buta-1,3-dienyl]-8-ethyl-6-[(3E)-3-ethylpenta-1,3-dien-2-yl]-12,12-dimethyltrideca-2,4,8-trien-1-imine |
|---|---|
| PubChem CID | 143682431 |
| Molecular Formula | C28H43N |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | (2Z,4E,8E)-5-[(1Z)-buta-1,3-dienyl]-8-ethyl-6-[(3E)-3-ethylpenta-1,3-dien-2-yl]-12,12-dimethyltrideca-2,4,8-trien-1-imine |
| SMILES | [H]/N=C\C=C/C=C(\C=C/C=C)C(C/C(=C/CCC(C)(C)C)CC)C(=C)/C(=C/C)CC |
| InChI | InChI=1S/C28H43N/c1-9-13-18-26(19-14-15-21-29)27(23(5)25(11-3)12-4)22-24(10-2)17-16-20-28(6,7)8/h9,11,13-15,17-19,21,27,29H,1,5,10,12,16,20,22H2,2-4,6-8H3/b15-14-,18-13-,24-17+,25-11+,26-19+,29-21- |
| InChIKey | UUXWOXNBERPRHT-TWVKQCQESA-N |
| XLogP | 8.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|