C17H25F4N — CID 143682667
(3Z,6Z)-6-fluoro-2-methyl-N-[(3E)-3-methylpenta-1,3-dien-2-yl]-7-(trifluoromethyl)nona-3,6-dien-1-amine (PubChem CID 143682667) has the molecular formula C17H25F4N and a molecular weight of 319.39 g/mol. Its IUPAC name is (3Z,6Z)-6-fluoro-2-methyl-N-[(3E)-3-methylpenta-1,3-dien-2-yl]-7-(trifluoromethyl)nona-3,6-dien-1-amine.
| Compound Name | (3Z,6Z)-6-fluoro-2-methyl-N-[(3E)-3-methylpenta-1,3-dien-2-yl]-7-(trifluoromethyl)nona-3,6-dien-1-amine |
|---|---|
| PubChem CID | 143682667 |
| Molecular Formula | C17H25F4N |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (3Z,6Z)-6-fluoro-2-methyl-N-[(3E)-3-methylpenta-1,3-dien-2-yl]-7-(trifluoromethyl)nona-3,6-dien-1-amine |
| SMILES | C=C(NCC(C)/C=C\C/C(F)=C(\CC)C(F)(F)F)/C(C)=C/C |
| InChI | InChI=1S/C17H25F4N/c1-6-13(4)14(5)22-11-12(3)9-8-10-16(18)15(7-2)17(19,20)21/h6,8-9,12,22H,5,7,10-11H2,1-4H3/b9-8-,13-6+,16-15- |
| InChIKey | QNUBWKSISDFSLG-AOCAGKJESA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|