C18H33N3 — CID 143682888
10-cyclohepta-2,4,6-trien-1-yl-1-(2-methylhydrazinyl)decan-4-amine (PubChem CID 143682888) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 10-cyclohepta-2,4,6-trien-1-yl-1-(2-methylhydrazinyl)decan-4-amine.
| Compound Name | 10-cyclohepta-2,4,6-trien-1-yl-1-(2-methylhydrazinyl)decan-4-amine |
|---|---|
| PubChem CID | 143682888 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 10-cyclohepta-2,4,6-trien-1-yl-1-(2-methylhydrazinyl)decan-4-amine |
| SMILES | CNNCCCC(N)CCCCCCC1C=CC=CC=C1 |
| InChI | InChI=1S/C18H33N3/c1-20-21-16-10-15-18(19)14-9-5-4-8-13-17-11-6-2-3-7-12-17/h2-3,6-7,11-12,17-18,20-21H,4-5,8-10,13-16,19H2,1H3 |
| InChIKey | WHBNGBXMOJDNMI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|