C21H35N — CID 143683516
(2E,9Z,11Z)-N,3,11-trimethyl-9-(2-methylbutyl)trideca-2,9,11-trien-7-yn-4-amine (PubChem CID 143683516) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (2E,9Z,11Z)-N,3,11-trimethyl-9-(2-methylbutyl)trideca-2,9,11-trien-7-yn-4-amine.
| Compound Name | (2E,9Z,11Z)-N,3,11-trimethyl-9-(2-methylbutyl)trideca-2,9,11-trien-7-yn-4-amine |
|---|---|
| PubChem CID | 143683516 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (2E,9Z,11Z)-N,3,11-trimethyl-9-(2-methylbutyl)trideca-2,9,11-trien-7-yn-4-amine |
| SMILES | C/C=C(C)\C=C(/C#CCCC(NC)/C(C)=C/C)CC(C)CC |
| InChI | InChI=1S/C21H35N/c1-8-17(4)15-20(16-18(5)9-2)13-11-12-14-21(22-7)19(6)10-3/h8,10,15,18,21-22H,9,12,14,16H2,1-7H3/b17-8-,19-10+,20-15+ |
| InChIKey | WMZGBZSANYFVOP-IWXVQACASA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|