C23H43NS — CID 143683663
(5Z,7Z)-2-tert-butylsulfanyl-N,14,14-trimethyl-13-methylidenepentadeca-5,7-dien-5-amine (PubChem CID 143683663) has the molecular formula C23H43NS and a molecular weight of 365.67 g/mol. Its IUPAC name is (5Z,7Z)-2-tert-butylsulfanyl-N,14,14-trimethyl-13-methylidenepentadeca-5,7-dien-5-amine.
| Compound Name | (5Z,7Z)-2-tert-butylsulfanyl-N,14,14-trimethyl-13-methylidenepentadeca-5,7-dien-5-amine |
|---|---|
| PubChem CID | 143683663 |
| Molecular Formula | C23H43NS |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | (5Z,7Z)-2-tert-butylsulfanyl-N,14,14-trimethyl-13-methylidenepentadeca-5,7-dien-5-amine |
| SMILES | C=C(CCCC/C=C\C=C(\CCC(C)SC(C)(C)C)NC)C(C)(C)C |
| InChI | InChI=1S/C23H43NS/c1-19(22(3,4)5)15-13-11-10-12-14-16-21(24-9)18-17-20(2)25-23(6,7)8/h12,14,16,20,24H,1,10-11,13,15,17-18H2,2-9H3/b14-12-,21-16- |
| InChIKey | LPUFEWMDLVHRHV-NUOPWSFOSA-N |
| XLogP | 7.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|