C19H18O3 — CID 143684631
2,3b,5-trimethyl-2,4-dihydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione (PubChem CID 143684631) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,3b,5-trimethyl-2,4-dihydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione.
| Compound Name | 2,3b,5-trimethyl-2,4-dihydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
|---|---|
| PubChem CID | 143684631 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2,3b,5-trimethyl-2,4-dihydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| SMILES | CC1=c2ccccc2=C2C(=O)C(=O)C3=C(OC(C)C3)C2(C)C1 |
| InChI | InChI=1S/C19H18O3/c1-10-9-19(3)15(13-7-5-4-6-12(10)13)17(21)16(20)14-8-11(2)22-18(14)19/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | KHHGUQAFGJGJTP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|