C18H22O3 — CID 143684686
(7E,9Z,11E)-2,2,7,9,10-pentamethyl-3,4-dihydrocyclodeca[b]pyran-5,6-dione (PubChem CID 143684686) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (7E,9Z,11E)-2,2,7,9,10-pentamethyl-3,4-dihydrocyclodeca[b]pyran-5,6-dione.
| Compound Name | (7E,9Z,11E)-2,2,7,9,10-pentamethyl-3,4-dihydrocyclodeca[b]pyran-5,6-dione |
|---|---|
| PubChem CID | 143684686 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (7E,9Z,11E)-2,2,7,9,10-pentamethyl-3,4-dihydrocyclodeca[b]pyran-5,6-dione |
| SMILES | CC1=C(C)/C=C(\C)C(=O)C(=O)C2=C(/C=C/1)OC(C)(C)CC2 |
| InChI | InChI=1S/C18H22O3/c1-11-6-7-15-14(8-9-18(4,5)21-15)17(20)16(19)13(3)10-12(11)2/h6-7,10H,8-9H2,1-5H3/b7-6+,12-11-,13-10+ |
| InChIKey | NWXAUTSVLIFXHW-CJXIBTPVSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|