About 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine
7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 143684921) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 143684921 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | C1=Cc2ccccc2C=CC1.CNC1=CCC(C)C(OC)=C1 |
| InChI | InChI=1S/C11H10.C9H15NO/c1-2-6-10-8-4-5-9-11(10)7-3-1;1-7-4-5-8(10-2)6-9(7)11-3/h2-9H,1H2;5-7,10H,4H2,1-3H3 |
| InChIKey | MXEKTKCDVWQFKG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine (CID 143684921) is 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine is C1=Cc2ccccc2C=CC1.CNC1=CCC(C)C(OC)=C1.
What is the InChIKey of 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine?
The InChIKey is MXEKTKCDVWQFKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C9H15NO/c1-2-6-10-8-4-5-9-11(10)7-3-1;1-7-4-5-8(10-2)6-9(7)11-3/h2-9H,1H2;5-7,10H,4H2,1-3H3.
What are the key properties of 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine?
7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine has a molecular weight of 295.43 g/mol, XLogP of 4.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-benzo[7]annulene;5-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 143684921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).