C19H22N2O2 — CID 143685051
(1E,3Z,5E)-N-methyl-N-[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-5-nitrohepta-1,3,5-trien-1-amine (PubChem CID 143685051) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (1E,3Z,5E)-N-methyl-N-[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-5-nitrohepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5E)-N-methyl-N-[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-5-nitrohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143685051 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (1E,3Z,5E)-N-methyl-N-[(1E)-1-(2-methylphenyl)buta-1,3-dienyl]-5-nitrohepta-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\c1ccccc1C)N(C)/C=C/C=C\C(=C/C)[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N2O2/c1-5-11-19(18-14-8-7-12-16(18)3)20(4)15-10-9-13-17(6-2)21(22)23/h5-15H,1H2,2-4H3/b13-9-,15-10+,17-6+,19-11+ |
| InChIKey | RIGNVQWLIWWSIU-CMKMUAEESA-N |
| XLogP | 4.70 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|