C41H36N2 — CID 143685408
N-[4-[4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]phenyl]phenyl]-N-(3-phenylphenyl)naphthalen-2-amine (PubChem CID 143685408) has the molecular formula C41H36N2 and a molecular weight of 556.75 g/mol. Its IUPAC name is N-[4-[4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]phenyl]phenyl]-N-(3-phenylphenyl)naphthalen-2-amine.
| Compound Name | N-[4-[4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]phenyl]phenyl]-N-(3-phenylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 143685408 |
| Molecular Formula | C41H36N2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | N-[4-[4-[[(2E,4Z)-hexa-2,4-dien-2-yl]-methylamino]phenyl]phenyl]-N-(3-phenylphenyl)naphthalen-2-amine |
| SMILES | C/C=C\C=C(/C)N(C)c1ccc(-c2ccc(N(c3cccc(-c4ccccc4)c3)c3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C41H36N2/c1-4-5-12-31(2)42(3)38-24-19-34(20-25-38)35-21-26-39(27-22-35)43(41-28-23-33-15-9-10-16-36(33)30-41)40-18-11-17-37(29-40)32-13-7-6-8-14-32/h4-30H,1-3H3/b5-4-,31-12+ |
| InChIKey | UNJFEKMSOMPOBD-LXYNSNNSSA-N |
| XLogP | 11.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|