C26H39Cl4N4O9PS — CID 143685432
5-[[3-[2-[bis[bis(2-chloroethyl)amino]phosphanyloxy]ethylsulfonyl]-1-[[carboxy(phenyl)methyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 143685432) has the molecular formula C26H39Cl4N4O9PS and a molecular weight of 756.47 g/mol. Its IUPAC name is 5-[[3-[2-[bis[bis(2-chloroethyl)amino]phosphanyloxy]ethylsulfonyl]-1-[[carboxy(phenyl)methyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[2-[bis[bis(2-chloroethyl)amino]phosphanyloxy]ethylsulfonyl]-1-[[carboxy(phenyl)methyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143685432 |
| Molecular Formula | C26H39Cl4N4O9PS |
| Molecular Weight | 756.47 g/mol |
| Exact Mass | 754.09 |
| IUPAC Name | 5-[[3-[2-[bis[bis(2-chloroethyl)amino]phosphanyloxy]ethylsulfonyl]-1-[[carboxy(phenyl)methyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NC(CS(=O)(=O)CCOP(N(CCCl)CCCl)N(CCCl)CCCl)C(=O)NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H39Cl4N4O9PS/c27-9-13-33(14-10-28)44(34(15-11-29)16-12-30)43-17-18-45(41,42)19-21(31-22(35)7-4-8-23(36)37)25(38)32-24(26(39)40)20-5-2-1-3-6-20/h1-3,5-6,21,24H,4,7-19H2,(H,31,35)(H,32,38)(H,36,37)(H,39,40) |
| InChIKey | JTZGKHWHZXDEOB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 182.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|