C24H36N4O3 — CID 143685725
2-N-(2-propoxyethyl)-5-N-[(2,3,3-trimethylcyclohexyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide (PubChem CID 143685725) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-N-(2-propoxyethyl)-5-N-[(2,3,3-trimethylcyclohexyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-propoxyethyl)-5-N-[(2,3,3-trimethylcyclohexyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 143685725 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 2-N-(2-propoxyethyl)-5-N-[(2,3,3-trimethylcyclohexyl)methyl]imidazo[1,2-a]pyridine-2,5-dicarboxamide |
| SMILES | CCCOCCNC(=O)c1cn2c(C(=O)NCC3CCCC(C)(C)C3C)cccc2n1 |
| InChI | InChI=1S/C24H36N4O3/c1-5-13-31-14-12-25-22(29)19-16-28-20(9-6-10-21(28)27-19)23(30)26-15-18-8-7-11-24(3,4)17(18)2/h6,9-10,16-18H,5,7-8,11-15H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | UXNRQXCSEPMCTO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|